Quinoline

This page lists Quinoline compounds supplied by ReagentForLab: 4,596 products in total, each identified by its CAS Registry Number. Examples include 4-Quinolinamine, N-(3-bromopropyl)-7-chloro- (CAS 60548-23-4), 8-Quinolinamine, 6-chloro-2-methyl- (CAS 61854-63-5), Quinolinium, 1-ethyl- (CAS 48122-97-0), N-phenyl-3-(quinolin-2-yl)propanamide (CAS 20745-55-5), Ethanimidamide, N-(2-chloro-1-oxopropoxy)-2-(8-quinolinyloxy)- (CAS 88758-00-3). Open a product page for its molecular formula, identifiers and synonyms, or send an inquiry for purity, packaging, price and lead time.

  1. 2026-11-15 Dedicated to providing high-quality products and excellent services to serve global advanced customers. ReagentForLab lists 4,596 Quinoline compounds by CAS number. Request a quote for research or bulk quantities. raw material synthesis manufacturer cas no factories suppliers high purity cost application price cdmo manufacturers purchase wholesale structure of use distributor for sale sales distributors supplier cmo manufacturing cdmo .
  2. 2-Pyridinecarboxylicacid, 6-(methoxymethyl)-
    354517-76-3
  3. 5-Benzofuranmethanol, 2,3-dihydro-4,7-dimethoxy-alpha-(2-(4-methoxyphenyl)ethyl)-6-(2-(1-pyrrolidinyl)ethoxy)-
    54279-58-2
  4. Benzenaminium, N-methyl-N-(6-phenyl-2H-1,3-selenazin-2-ylidene)-,perchlorate
    60563-63-5
  5. Bromo(cyclohexyl)acetic acid
    5428-00-2
  6. 4-Chloro-5,8-dimethoxyquinoline
    5428-11-5
  7. 1-Pentanone, 1-(4-methoxyphenyl)-4-methyl-4-nitro-3-phenyl-
    54254-50-1
  8. 2-Bromo-1-chloro-1,1,2-trifluoroethane
  9. Gemcadiol
  10. 1-Methyl-3,4-dihydro-4-thioxopyrimidine 2(1H)-one
  11. 2,2-dichloro-1,3-diphenylaziridine
  12. 60548-23-4
  13. 61854-63-5
  14. 48122-97-0
  15. 20745-55-5
  16. 88758-00-3
  17. 88758-16-1
  18. 88758-17-2
  19. 88758-38-7
  2. Triazole
  3. tert-Butyloxy
  4. Ketnone
  5. Quinoline
  6. Thiadiazole
  7. Thiazole
  8. Triol
  9. Tetrol
  10. Biphenyl
  11. Cyano
  12. -carbonyl
  13. Carbonyl
  14. Quinoline Provider